Products 1139717-76-2
CAS 1139717-76-2 appears in our catalog under these names: 3-(4-Methylpiperazin-1-yl)phenylboronic acid, 96%, 3-(4-Methyl-1-piperazinyl)phenylboronic acid, 95-<97%, 3-(4-Methyl-1-piperazinyl)phenylboronic acid, ≥97-<99%, 3–(4–Methyl–1–piperazinyl)phenylboronic Acid, 3-(4-Methyl-1-piperazinyl)phenylboronic Acid, 98%, 98%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 5g, 1g, 2,5g, 10g, 25g, 50g, 100g.
[3-(4-methylpiperazin-1-yl)phenyl]boronic acid (CAS 1139717-76-2) is a chemical compound with the molecular formula C11H17BN2O2 and a molecular weight of 220.08 g/mol. IUPAC name: [3-(4-methylpiperazin-1-yl)phenyl]boronic acid. InChIKey: HXGDRMHRVSAMGD-UHFFFAOYSA-N.
| Molecular formula | C11H17BN2O2 |
|---|---|
| Molecular weight | 220.08 g/mol |
| IUPAC name | [3-(4-methylpiperazin-1-yl)phenyl]boronic acid |
| InChIKey | HXGDRMHRVSAMGD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)N2CCN(CC2)C)(O)O |
Computed by PubChem (NCBI)