(4-Amino-2-methylphenyl)dimethylphosphine oxide, 95%
cas: 2361948-73-2 — see every product listed under this CAS number, including other names
(4-Amino-2-methylphenyl)dimethylphosphine oxide, 95% (CAS 2361948-73-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 50mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1495224-100mg |
| cas | 2361948-73-2 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1004.50 Pln | |
| Ambeed | 250mg | 1655.31 Pln | |
| BLDpharm | 50mg | 614.25 Pln | |
| BLDpharm | 100mg | 986.34 Pln | |
| BLDpharm | 250mg | 1625.01 Pln | |
| Chemat | 50mg | 602.00 Pln | |
| Chemat | 100mg | 981.20 Pln | |
| Fluorochem | 50mg | 1106.92 Pln | |
| Fluorochem | 100mg | 1809.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
4-dimethylphosphoryl-3-methylaniline (CAS 2361948-73-2) is a chemical compound with the molecular formula C9H14NOP and a molecular weight of 183.19 g/mol. IUPAC name: 4-dimethylphosphoryl-3-methylaniline. InChIKey: NGOZNFGAQWLXRY-UHFFFAOYSA-N.
| Molecular formula | C9H14NOP |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 4-dimethylphosphoryl-3-methylaniline |
| InChIKey | NGOZNFGAQWLXRY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)N)P(=O)(C)C |
Computed by PubChem (NCBI)