Products 2490402-43-0
CAS 2490402-43-0 appears in our catalog under these names: (2-Amino-5-methylphenyl)dimethylphosphine oxide, 95%, 95%, (2-Amino-5-methylphenyl)dimethylphosphine oxide, 98%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-dimethylphosphoryl-4-methylaniline (CAS 2490402-43-0) is a chemical compound with the molecular formula C9H14NOP and a molecular weight of 183.19 g/mol. IUPAC name: 2-dimethylphosphoryl-4-methylaniline. InChIKey: RVKDPIRKOIFKBO-UHFFFAOYSA-N.
| Molecular formula | C9H14NOP |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 2-dimethylphosphoryl-4-methylaniline |
| InChIKey | RVKDPIRKOIFKBO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)N)P(=O)(C)C |
Computed by PubChem (NCBI)