Products 1197956-24-3
CAS 1197956-24-3 appears in our catalog under these names: (4-Amino-3-methylphenyl)dimethylphosphine oxide, 97%, (4-Amino-3-methylphenyl)dimethylphosphine oxide, 97%, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g.
4-dimethylphosphoryl-2-methylaniline (CAS 1197956-24-3) is a chemical compound with the molecular formula C9H14NOP and a molecular weight of 183.19 g/mol. IUPAC name: 4-dimethylphosphoryl-2-methylaniline. InChIKey: JNBUHVMBJYXHDI-UHFFFAOYSA-N.
| Molecular formula | C9H14NOP |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 4-dimethylphosphoryl-2-methylaniline |
| InChIKey | JNBUHVMBJYXHDI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)P(=O)(C)C)N |
Computed by PubChem (NCBI)