CAS 2361982-50-3 appears in our catalog under these names: (2-Amino-4-methylphenyl)dimethylphosphine oxide, 95%, 95%, (2-Amino-4-methylphenyl)dimethylphosphine oxide, 95%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 250mg.
2-dimethylphosphoryl-5-methylaniline (CAS 2361982-50-3) is a chemical compound with the molecular formula C9H14NOP and a molecular weight of 183.19 g/mol. IUPAC name: 2-dimethylphosphoryl-5-methylaniline. InChIKey: MVIYSMQLPXOSFZ-UHFFFAOYSA-N.
| Molecular formula | C9H14NOP |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 2-dimethylphosphoryl-5-methylaniline |
| InChIKey | MVIYSMQLPXOSFZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)P(=O)(C)C)N |
Computed by PubChem (NCBI)