(4-Amino-3-methylphenyl)dimethylphosphine oxide, 97%
cas: 1197956-24-3 — see every product listed under this CAS number, including other names
(4-Amino-3-methylphenyl)dimethylphosphine oxide, 97% (CAS 1197956-24-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A1360485-250mg |
| cas | 1197956-24-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 492.75 Pln | |
| Ambeed | 1g | 1210.31 Pln | |
| BLDpharm | 50mg | 242.16 Pln | |
| BLDpharm | 100mg | 342.13 Pln | |
| BLDpharm | 250mg | 525.40 Pln | |
| BLDpharm | 1g | 1302.90 Pln | |
| Chemat | 50mg | 198.80 Pln | |
| Chemat | 100mg | 275.60 Pln | |
| Chemat | 250mg | 424.40 Pln | |
| Chemat | 1g | 1043.60 Pln | |
| Fluorochem | 50mg | 341.56 Pln | |
| Fluorochem | 100mg | 492.55 Pln | |
| Fluorochem | 250mg | 768.50 Pln | |
| Fluorochem | 1g | 1929.55 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
4-dimethylphosphoryl-2-methylaniline (CAS 1197956-24-3) is a chemical compound with the molecular formula C9H14NOP and a molecular weight of 183.19 g/mol. IUPAC name: 4-dimethylphosphoryl-2-methylaniline. InChIKey: JNBUHVMBJYXHDI-UHFFFAOYSA-N.
| Molecular formula | C9H14NOP |
|---|---|
| Molecular weight | 183.19 g/mol |
| IUPAC name | 4-dimethylphosphoryl-2-methylaniline |
| InChIKey | JNBUHVMBJYXHDI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CC(=C1)P(=O)(C)C)N |
Computed by PubChem (NCBI)