cas: 1137-41-3 — see every product listed under this CAS number, including other names
(4-Aminophenyl)(phenyl)methanone, 98%, 98% (CAS 1137-41-3) is a chemical reagent available from Chemat. Available pack sizes: 50g, 1kg, 5g, 10g, 25g, 100g, 200g, 300g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1110D9-50g |
| cas | 1137-41-3 |
| size | 50g |
| availability | 2000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50g | 131.60 Pln | |
| Chemat | 1kg | 861.20 Pln | |
| Chemat | 5g | 78.80 Pln | |
| Chemat | 10g | 78.80 Pln | |
| Chemat | 25g | 93.20 Pln | |
| Chemat | 100g | 170.00 Pln | |
| Chemat | 200g | 266.00 Pln | |
| Chemat | 300g | 366.80 Pln | |
| Chemat | 500g | 470.40 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-aminophenyl)-phenylmethanone (CAS 1137-41-3) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: (4-aminophenyl)-phenylmethanone. InChIKey: RBKHNGHPZZZJCI-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (4-aminophenyl)-phenylmethanone |
| InChIKey | RBKHNGHPZZZJCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)