cas: 1137-41-3 — see every product listed under this CAS number, including other names
4-Aminobenzophenone, 95% (CAS 1137-41-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F092544-5G |
| cas | 1137-41-3 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 91.65 Pln | |
| Fluorochem | 10g | 102.07 Pln | |
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 50g | 174.96 Pln | |
| Fluorochem | 100g | 206.20 Pln | |
| Fluorochem | 500g | 622.72 Pln | |
| Fluorochem | 1kg | 981.96 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(4-aminophenyl)-phenylmethanone (CAS 1137-41-3) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: (4-aminophenyl)-phenylmethanone. InChIKey: RBKHNGHPZZZJCI-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (4-aminophenyl)-phenylmethanone |
| InChIKey | RBKHNGHPZZZJCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)