4-Aminobenzophenone, 95%
cas: 1137-41-3 — see every product listed under this CAS number, including other names
4-Aminobenzophenone, 95% (CAS 1137-41-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 50g, 100g, 500g, 1kg. Offered by: Fluorochem, Ambeed.
| brand | Fluorochem |
|---|---|
| catalog number | F092544-5G |
| cas | 1137-41-3 |
| size | 5g |
| availability | In Stock China |
Documents:
Safety Data Sheet (MSDS)
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 102.07 Pln | |
| Fluorochem | 10g | 107.27 Pln | |
| Fluorochem | 25g | 122.89 Pln | |
| Fluorochem | 50g | 185.37 Pln | |
| Fluorochem | 100g | 227.02 Pln | |
| Fluorochem | 500g | 653.95 Pln | |
| Fluorochem | 1kg | 1039.24 Pln | |
| Ambeed | 10g | 125.62 Pln | |
| Ambeed | 25g | 159.00 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 993.38 Pln | |
| Ambeed | 1kg | 1588.56 Pln |
properties
| purity | 95% |
|---|---|
| dual use | No |
| currency | EUR |
| delivery time | 2-3 weeks |
| category | Odczynniki chemiczne |
(4-aminophenyl)-phenylmethanone (CAS 1137-41-3) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: (4-aminophenyl)-phenylmethanone. InChIKey: RBKHNGHPZZZJCI-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (4-aminophenyl)-phenylmethanone |
| InChIKey | RBKHNGHPZZZJCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)