cas: 1137-41-3 — see every product listed under this CAS number, including other names
4-Aminobenzophenone 95% (CAS 1137-41-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 25g, 100g, 500g, 1000g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A355876-10g |
| cas | 1137-41-3 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 125.62 Pln | |
| Ambeed | 25g | 159.00 Pln | |
| Ambeed | 100g | 381.50 Pln | |
| Ambeed | 500g | 982.25 Pln | |
| Ambeed | 1000g | 1571.88 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A355876 |
(4-aminophenyl)-phenylmethanone (CAS 1137-41-3) is a chemical compound with the molecular formula C13H11NO and a molecular weight of 197.23 g/mol. IUPAC name: (4-aminophenyl)-phenylmethanone. InChIKey: RBKHNGHPZZZJCI-UHFFFAOYSA-N.
| Molecular formula | C13H11NO |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | (4-aminophenyl)-phenylmethanone |
| InChIKey | RBKHNGHPZZZJCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)N |
Computed by PubChem (NCBI)