cas: 1171497-43-0 — see every product listed under this CAS number, including other names
(4-Aminopiperidin-1-yl)(pyridin-4-yl)methanone dihydrochloride, 98% (CAS 1171497-43-0) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A766847-10g |
| cas | 1171497-43-0 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 19398.19 Pln | |
| AmBeed | 5g | 14203.21 Pln | |
| Fluorochem | 100mg | 836.18 Pln | |
| Fluorochem | 250mg | 1169.40 Pln | |
| Fluorochem | 500mg | 1788.97 Pln | |
| Fluorochem | 1g | 2273.18 Pln | |
| Fluorochem | 5g | 6573.74 Pln | |
| Chemat | 100mg | 582.80 Pln | |
| Chemat | 250mg | 808.40 Pln | |
| Chemat | 1g | 1571.60 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-aminopiperidin-1-yl)-pyridin-4-ylmethanone;dihydrochloride (CAS 1171497-43-0) is a chemical compound with the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. IUPAC name: (4-aminopiperidin-1-yl)-pyridin-4-ylmethanone;dihydrochloride. InChIKey: IEMVQVGVQLRTMI-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3O |
|---|---|
| Molecular weight | 278.18 g/mol |
| IUPAC name | (4-aminopiperidin-1-yl)-pyridin-4-ylmethanone;dihydrochloride |
| InChIKey | IEMVQVGVQLRTMI-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C(=O)C2=CC=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)