CAS 1609388-34-2 is the registry number for (5S)-5-([(3-Pyridinylmethyl)amino]methyl)-2-pyrrolidinone dihydrochloride, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 10g, 5g, 1g.
(5S)-5-[(pyridin-3-ylmethylamino)methyl]pyrrolidin-2-one;dihydrochloride (CAS 1609388-34-2) is a chemical compound with the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. IUPAC name: (5S)-5-[(pyridin-3-ylmethylamino)methyl]pyrrolidin-2-one;dihydrochloride. InChIKey: SLVRPCSHSKLPDW-XRIOVQLTSA-N.
| Molecular formula | C11H17Cl2N3O |
|---|---|
| Molecular weight | 278.18 g/mol |
| IUPAC name | (5S)-5-[(pyridin-3-ylmethylamino)methyl]pyrrolidin-2-one;dihydrochloride |
| InChIKey | SLVRPCSHSKLPDW-XRIOVQLTSA-N |
| SMILES | C1CC(=O)N[C@@H]1CNCC2=CN=CC=C2.Cl.Cl |
Computed by PubChem (NCBI)