Products 1240527-21-2
CAS 1240527-21-2 appears in our catalog under these names: 1-(Piperazin-1-yl)-2-(pyridin-2-yl)ethan-1-one Dihydrochloride, 1-(Piperazin-1-yl)-2-(pyridin-2-yl)ethan-1-one dihydrochloride, 95%. Offered by: TRC, Biosynth, AmBeed. Available pack sizes: 1g, 50mg, 0,5g, 10g.
1-piperazin-1-yl-2-pyridin-2-ylethanone;dihydrochloride (CAS 1240527-21-2) is a chemical compound with the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. IUPAC name: 1-piperazin-1-yl-2-pyridin-2-ylethanone;dihydrochloride. InChIKey: BUZOCPDOHYAPQX-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3O |
|---|---|
| Molecular weight | 278.18 g/mol |
| IUPAC name | 1-piperazin-1-yl-2-pyridin-2-ylethanone;dihydrochloride |
| InChIKey | BUZOCPDOHYAPQX-UHFFFAOYSA-N |
| SMILES | C1CN(CCN1)C(=O)CC2=CC=CC=N2.Cl.Cl |
Computed by PubChem (NCBI)