CAS 1171497-43-0 appears in our catalog under these names: (4-Aminopiperidin-1-yl)(pyridin-4-yl)methanone dihydrochloride, 98%, (4-Aminopiperidin-1-yl)(pyridin-4-yl)methanone dihydrochloride, 98%, 98%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 100mg, 250mg, 1g, 500mg.
(4-aminopiperidin-1-yl)-pyridin-4-ylmethanone;dihydrochloride (CAS 1171497-43-0) is a chemical compound with the molecular formula C11H17Cl2N3O and a molecular weight of 278.18 g/mol. IUPAC name: (4-aminopiperidin-1-yl)-pyridin-4-ylmethanone;dihydrochloride. InChIKey: IEMVQVGVQLRTMI-UHFFFAOYSA-N.
| Molecular formula | C11H17Cl2N3O |
|---|---|
| Molecular weight | 278.18 g/mol |
| IUPAC name | (4-aminopiperidin-1-yl)-pyridin-4-ylmethanone;dihydrochloride |
| InChIKey | IEMVQVGVQLRTMI-UHFFFAOYSA-N |
| SMILES | C1CN(CCC1N)C(=O)C2=CC=NC=C2.Cl.Cl |
Computed by PubChem (NCBI)