cas: 924312-09-4 — see every product listed under this CAS number, including other names
(4-Bromo-2-fluorophenyl)acetic acid ethyl ester, 98% (CAS 924312-09-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g, 100g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F094837-5G |
| cas | 924312-09-4 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 570.65 Pln | |
| Fluorochem | 10g | 914.28 Pln | |
| Fluorochem | 25g | 1757.73 Pln | |
| Fluorochem | 100g | 4496.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
Ethyl 2-(4-bromo-2-fluorophenyl)acetate (CAS 924312-09-4) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: ethyl 2-(4-bromo-2-fluorophenyl)acetate. InChIKey: NAIAJPLUTCZXKC-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | ethyl 2-(4-bromo-2-fluorophenyl)acetate |
| InChIKey | NAIAJPLUTCZXKC-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)