CAS 2221812-38-8 appears in our catalog under these names: 2-(6-Bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane, 95%, 2-(6-Bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane, ≥95%, ≥95%, 2-(6-Bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
2-(6-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane (CAS 2221812-38-8) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: 2-(6-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane. InChIKey: WEOZHUCEGDZWNE-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | 2-(6-bromo-2-fluoro-3-methylphenyl)-1,3-dioxolane |
| InChIKey | WEOZHUCEGDZWNE-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=C(C=C1)Br)C2OCCO2)F |
Computed by PubChem (NCBI)