CAS 1456234-21-1 appears in our catalog under these names: Propan-2-yl 4-bromo-2-fluorobenzoate, 97%, Isopropyl 4-bromo-2-fluorobenzoate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g.
Propan-2-yl 4-bromo-2-fluorobenzoate (CAS 1456234-21-1) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: propan-2-yl 4-bromo-2-fluorobenzoate. InChIKey: SXDSWYPZHLAGPK-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | propan-2-yl 4-bromo-2-fluorobenzoate |
| InChIKey | SXDSWYPZHLAGPK-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)C1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)