CAS 1257107-61-1 appears in our catalog under these names: 3-(4-Bromo-2-fluoro-phenyl)-propionic acid methyl ester, 98%, Methyl 3-(4-bromo-2-fluorophenyl)propanoate, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
Methyl 3-(4-bromo-2-fluorophenyl)propanoate (CAS 1257107-61-1) is a chemical compound with the molecular formula C10H10BrFO2 and a molecular weight of 261.09 g/mol. IUPAC name: methyl 3-(4-bromo-2-fluorophenyl)propanoate. InChIKey: YVMPMQXVOMBNQA-UHFFFAOYSA-N.
| Molecular formula | C10H10BrFO2 |
|---|---|
| Molecular weight | 261.09 g/mol |
| IUPAC name | methyl 3-(4-bromo-2-fluorophenyl)propanoate |
| InChIKey | YVMPMQXVOMBNQA-UHFFFAOYSA-N |
| SMILES | COC(=O)CCC1=C(C=C(C=C1)Br)F |
Computed by PubChem (NCBI)