cas: 870196-03-5 — see every product listed under this CAS number, including other names
(4-Bromo-3-(methoxycarbonyl)phenyl)boronic acid, 98% (CAS 870196-03-5) is a chemical reagent available from Chemat. Available pack sizes: 10g, 5g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1634160-10g |
| cas | 870196-03-5 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 17588.41 Pln | |
| AmBeed | 5g | 10394.86 Pln | |
| AmBeed | 25g | 34514.41 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-bromo-3-methoxycarbonylphenyl)boronic acid (CAS 870196-03-5) is a chemical compound with the molecular formula C8H8BBrO4 and a molecular weight of 258.86 g/mol. IUPAC name: (4-bromo-3-methoxycarbonylphenyl)boronic acid. InChIKey: OUIKETNLSCVSSN-UHFFFAOYSA-N.
| Molecular formula | C8H8BBrO4 |
|---|---|
| Molecular weight | 258.86 g/mol |
| IUPAC name | (4-bromo-3-methoxycarbonylphenyl)boronic acid |
| InChIKey | OUIKETNLSCVSSN-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Br)C(=O)OC)(O)O |
Computed by PubChem (NCBI)