CAS 2225178-33-4 appears in our catalog under these names: 5-(Methoxycarbonyl)-2-bromophenylboronic acid, 95%, 5–(METHOXYCARBONYL)–2–BROMOPHENYLBORONIC ACID. Offered by: Combi-blocks, GLPBio. Available pack sizes: 10g, 5g, 250mg, 1g, 10mg, 25mg.
(2-bromo-5-methoxycarbonylphenyl)boronic acid (CAS 2225178-33-4) is a chemical compound with the molecular formula C8H8BBrO4 and a molecular weight of 258.86 g/mol. IUPAC name: (2-bromo-5-methoxycarbonylphenyl)boronic acid. InChIKey: DISRQTOWJXBYLZ-UHFFFAOYSA-N.
| Molecular formula | C8H8BBrO4 |
|---|---|
| Molecular weight | 258.86 g/mol |
| IUPAC name | (2-bromo-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | DISRQTOWJXBYLZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(=O)OC)Br)(O)O |
Computed by PubChem (NCBI)