CAS 1072951-80-4 appears in our catalog under these names: 3-Bromo-5-formyl-2-methoxyphenylboronic acid, 96%, (3-Bromo-5-formyl-2-methoxyphenyl)boronic acid 96%, (3-Bromo-5-formyl-2-methoxyphenyl)boronic acid, 96%. Offered by: Combi-blocks, Ambeed, Fluorochem. Available pack sizes: 1g, 5g, 250mg.
(3-bromo-5-formyl-2-methoxyphenyl)boronic acid (CAS 1072951-80-4) is a chemical compound with the molecular formula C8H8BBrO4 and a molecular weight of 258.86 g/mol. IUPAC name: (3-bromo-5-formyl-2-methoxyphenyl)boronic acid. InChIKey: UUPRSFVSYMWVRC-UHFFFAOYSA-N.
| Molecular formula | C8H8BBrO4 |
|---|---|
| Molecular weight | 258.86 g/mol |
| IUPAC name | (3-bromo-5-formyl-2-methoxyphenyl)boronic acid |
| InChIKey | UUPRSFVSYMWVRC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1OC)Br)C=O)(O)O |
Computed by PubChem (NCBI)