CAS 2096330-02-6 is the registry number for 7-Bromo-2,3-dihydro-1,4-benzodioxine-5-boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
(7-bromo-2,3-dihydro-1,4-benzodioxin-5-yl)boronic acid (CAS 2096330-02-6) is a chemical compound with the molecular formula C8H8BBrO4 and a molecular weight of 258.86 g/mol. IUPAC name: (7-bromo-2,3-dihydro-1,4-benzodioxin-5-yl)boronic acid. InChIKey: UKEMOTXHAVNTDA-UHFFFAOYSA-N.
| Molecular formula | C8H8BBrO4 |
|---|---|
| Molecular weight | 258.86 g/mol |
| IUPAC name | (7-bromo-2,3-dihydro-1,4-benzodioxin-5-yl)boronic acid |
| InChIKey | UKEMOTXHAVNTDA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC2=C1OCCO2)Br)(O)O |
Computed by PubChem (NCBI)