cas: 2121514-49-4 — see every product listed under this CAS number, including other names
(4-Bromo-3-chloro-2-fluorophenyl)boronic acid, 98% (CAS 2121514-49-4) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 10g, 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A1634517-250mg |
| cas | 2121514-49-4 |
| size | 250mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 250mg | 499.66 Pln | |
| AmBeed | 10g | 4366.60 Pln | |
| AmBeed | 100mg | 330.40 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-bromo-3-chloro-2-fluorophenyl)boronic acid (CAS 2121514-49-4) is a chemical compound with the molecular formula C6H4BBrClFO2 and a molecular weight of 253.26 g/mol. IUPAC name: (4-bromo-3-chloro-2-fluorophenyl)boronic acid. InChIKey: OHHNGHFCANJXQZ-UHFFFAOYSA-N.
| Molecular formula | C6H4BBrClFO2 |
|---|---|
| Molecular weight | 253.26 g/mol |
| IUPAC name | (4-bromo-3-chloro-2-fluorophenyl)boronic acid |
| InChIKey | OHHNGHFCANJXQZ-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)Br)Cl)F)(O)O |
Computed by PubChem (NCBI)