cas: 1701448-16-9 — see every product listed under this CAS number, including other names
(4-Bromo-3-hydroxyphenyl)boronic acid, 98+% (CAS 1701448-16-9) is a chemical reagent available from Chemat. Available pack sizes: 25g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A757437-25g |
| cas | 1701448-16-9 |
| size | 25g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 25g | 65235.10 Pln | |
| AmBeed | 5g | 19534.90 Pln | |
| AmBeed | 10g | 33244.96 Pln |
| purity | 98+% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4-bromo-3-hydroxyphenyl)boronic acid (CAS 1701448-16-9) is a chemical compound with the molecular formula C6H6BBrO3 and a molecular weight of 216.83 g/mol. IUPAC name: (4-bromo-3-hydroxyphenyl)boronic acid. InChIKey: CJZSBTMJFVLOFA-UHFFFAOYSA-N.
| Molecular formula | C6H6BBrO3 |
|---|---|
| Molecular weight | 216.83 g/mol |
| IUPAC name | (4-bromo-3-hydroxyphenyl)boronic acid |
| InChIKey | CJZSBTMJFVLOFA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Br)O)(O)O |
Computed by PubChem (NCBI)