CAS 89598-97-0 appears in our catalog under these names: (5-Bromo-2-hydroxyphenyl)boronic acid, 97%, 97%, 5-Bromo-2-hydroxybenzeneboronic acid, 96% , (5-Bromo-2-hydroxyphenyl)boronic acid, 95%. Offered by: Chemat, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 250mg, 1g, 5g.
(5-bromo-2-hydroxyphenyl)boronic acid (CAS 89598-97-0) is a chemical compound with the molecular formula C6H6BBrO3 and a molecular weight of 216.83 g/mol. IUPAC name: (5-bromo-2-hydroxyphenyl)boronic acid. InChIKey: XSXTWLOHAGPBNO-UHFFFAOYSA-N.
| Molecular formula | C6H6BBrO3 |
|---|---|
| Molecular weight | 216.83 g/mol |
| IUPAC name | (5-bromo-2-hydroxyphenyl)boronic acid |
| InChIKey | XSXTWLOHAGPBNO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)Br)O)(O)O |
Computed by PubChem (NCBI)