Products 2376742-37-7
CAS 2376742-37-7 appears in our catalog under these names: (3-Bromo-4-hydroxyphenyl)boronic acid, 95%, 3-Bromo-4-hydroxyphenylboronic Acid, >95%, >95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg.
(3-bromo-4-hydroxyphenyl)boronic acid (CAS 2376742-37-7) is a chemical compound with the molecular formula C6H6BBrO3 and a molecular weight of 216.83 g/mol. IUPAC name: (3-bromo-4-hydroxyphenyl)boronic acid. InChIKey: IAAQDHBNKYEFFD-UHFFFAOYSA-N.
| Molecular formula | C6H6BBrO3 |
|---|---|
| Molecular weight | 216.83 g/mol |
| IUPAC name | (3-bromo-4-hydroxyphenyl)boronic acid |
| InChIKey | IAAQDHBNKYEFFD-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)O)Br)(O)O |
Computed by PubChem (NCBI)