cas: 6952-89-2 — see every product listed under this CAS number, including other names
(4-Bromophenyl)(cyclopropyl)methanone 97% (CAS 6952-89-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A103023-250mg |
| cas | 6952-89-2 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 804.25 Pln | |
| Ambeed | 100g | 2417.38 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A103023 |
(4-bromophenyl)-cyclopropylmethanone (CAS 6952-89-2) is a chemical compound with the molecular formula C10H9BrO and a molecular weight of 225.08 g/mol. IUPAC name: (4-bromophenyl)-cyclopropylmethanone. InChIKey: QTHHOINSCNBYQO-UHFFFAOYSA-N.
| Molecular formula | C10H9BrO |
|---|---|
| Molecular weight | 225.08 g/mol |
| IUPAC name | (4-bromophenyl)-cyclopropylmethanone |
| InChIKey | QTHHOINSCNBYQO-UHFFFAOYSA-N |
| SMILES | C1CC1C(=O)C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)