cas: 956828-47-0 — see every product listed under this CAS number, including other names
(4-CHLORO-2-FLUORO-PHENYL)-CARBAMIC ACID TERT-BUTYL ESTER (CAS 956828-47-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F387653-250MG |
| cas | 956828-47-0 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 164.54 Pln | |
| Fluorochem | 1g | 279.09 Pln | |
| Fluorochem | 5g | 919.49 Pln | |
| Fluorochem | 25g | 3455.05 Pln |
| delivery time | 3-4 weeks |
|---|
Tert-butyl N-(4-chloro-2-fluorophenyl)carbamate (CAS 956828-47-0) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: tert-butyl N-(4-chloro-2-fluorophenyl)carbamate. InChIKey: SFOFUPMHMIGQMT-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | tert-butyl N-(4-chloro-2-fluorophenyl)carbamate |
| InChIKey | SFOFUPMHMIGQMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Cl)F |
Computed by PubChem (NCBI)