cas: 956828-47-0 — see every product listed under this CAS number, including other names
tert-Butyl (4-chloro-2-fluorophenyl)carbamate, 97%+,RG, 97%+,RG (CAS 956828-47-0) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IJCH-250mg |
| cas | 956828-47-0 |
| size | 250mg |
| availability | 250g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 573.20 Pln | |
| Chemat | 25g | 2104.40 Pln |
| purity | 97%+,RG |
|---|---|
| delivery time | 3 weeks |
Tert-butyl N-(4-chloro-2-fluorophenyl)carbamate (CAS 956828-47-0) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: tert-butyl N-(4-chloro-2-fluorophenyl)carbamate. InChIKey: SFOFUPMHMIGQMT-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | tert-butyl N-(4-chloro-2-fluorophenyl)carbamate |
| InChIKey | SFOFUPMHMIGQMT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC1=C(C=C(C=C1)Cl)F |
Computed by PubChem (NCBI)