Products 2209078-25-9
CAS 2209078-25-9 appears in our catalog under these names: (S,E)-Methyl 2-amino-4-(4-fluorophenyl)but-3-enoate hydrochloride, 95%, (S，E)–Methyl 2–amino–4–(4–fluorophenyl)but–3–enoate hydrochloride. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
Methyl (E,2S)-2-amino-4-(4-fluorophenyl)but-3-enoate;hydrochloride (CAS 2209078-25-9) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: methyl (E,2S)-2-amino-4-(4-fluorophenyl)but-3-enoate;hydrochloride. InChIKey: CKMPEKCUTAEYSV-SZZWBKDQSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | methyl (E,2S)-2-amino-4-(4-fluorophenyl)but-3-enoate;hydrochloride |
| InChIKey | CKMPEKCUTAEYSV-SZZWBKDQSA-N |
| SMILES | COC(=O)[C@H](/C=C/C1=CC=C(C=C1)F)N.Cl |
Computed by PubChem (NCBI)