Products 2306274-73-5
CAS 2306274-73-5 appears in our catalog under these names: Methyl 3-(4-fluorophenyl)azetidine-3-carboxylate hydrochloride, 95%, Methyl 3-(4-fluorophenyl)azetidine-3-carboxylate hydrochloride, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
Methyl 3-(4-fluorophenyl)azetidine-3-carboxylate;hydrochloride (CAS 2306274-73-5) is a chemical compound with the molecular formula C11H13ClFNO2 and a molecular weight of 245.68 g/mol. IUPAC name: methyl 3-(4-fluorophenyl)azetidine-3-carboxylate;hydrochloride. InChIKey: BPJBYKMDSVNSLI-UHFFFAOYSA-N.
| Molecular formula | C11H13ClFNO2 |
|---|---|
| Molecular weight | 245.68 g/mol |
| IUPAC name | methyl 3-(4-fluorophenyl)azetidine-3-carboxylate;hydrochloride |
| InChIKey | BPJBYKMDSVNSLI-UHFFFAOYSA-N |
| SMILES | COC(=O)C1(CNC1)C2=CC=C(C=C2)F.Cl |
Computed by PubChem (NCBI)