CAS 874219-46-2 appears in our catalog under these names: 1-Ethyl 5-borono-2-chlorobenzoate, 95-<97%, 4–Chloro–3–(ethoxycarbonyl)benzeneboronic acid, 96%, 4-Chloro-3-(ethoxycarbonyl)phenylboronic acid, 96%, 96%, (4-Chloro-3-(ethoxycarbonyl)phenyl)boronic acid, 98%. Offered by: Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 25g, 50g, 100g, 200g, 300g, 400g, 10g, 1g.
(4-chloro-3-ethoxycarbonylphenyl)boronic acid (CAS 874219-46-2) is a chemical compound with the molecular formula C9H10BClO4 and a molecular weight of 228.44 g/mol. IUPAC name: (4-chloro-3-ethoxycarbonylphenyl)boronic acid. InChIKey: HYQMEDIXHJXOND-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO4 |
|---|---|
| Molecular weight | 228.44 g/mol |
| IUPAC name | (4-chloro-3-ethoxycarbonylphenyl)boronic acid |
| InChIKey | HYQMEDIXHJXOND-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)Cl)C(=O)OCC)(O)O |
Computed by PubChem (NCBI)