CAS 850568-11-5 appears in our catalog under these names: 4–Ethoxycarbonyl–3–chlorophenylboronic acid, (3-Chloro-4-(ethoxycarbonyl)phenyl)boronic acid, 98%, 98%, (3-Chloro-4-(ethoxycarbonyl)phenyl)boronic acid, 98%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 5g.
(3-chloro-4-ethoxycarbonylphenyl)boronic acid (CAS 850568-11-5) is a chemical compound with the molecular formula C9H10BClO4 and a molecular weight of 228.44 g/mol. IUPAC name: (3-chloro-4-ethoxycarbonylphenyl)boronic acid. InChIKey: TXLCHOOKBILYOH-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO4 |
|---|---|
| Molecular weight | 228.44 g/mol |
| IUPAC name | (3-chloro-4-ethoxycarbonylphenyl)boronic acid |
| InChIKey | TXLCHOOKBILYOH-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C(=O)OCC)Cl)(O)O |
Computed by PubChem (NCBI)