Products 2828440-15-7
CAS 2828440-15-7 is the registry number for (4-Chloro-3-(methoxycarbonyl)-5-methylphenyl)boronic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(4-chloro-3-methoxycarbonyl-5-methylphenyl)boronic acid (CAS 2828440-15-7) is a chemical compound with the molecular formula C9H10BClO4 and a molecular weight of 228.44 g/mol. IUPAC name: (4-chloro-3-methoxycarbonyl-5-methylphenyl)boronic acid. InChIKey: CGGNUDREZJVRFQ-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO4 |
|---|---|
| Molecular weight | 228.44 g/mol |
| IUPAC name | (4-chloro-3-methoxycarbonyl-5-methylphenyl)boronic acid |
| InChIKey | CGGNUDREZJVRFQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C(=O)OC)Cl)C)(O)O |
Computed by PubChem (NCBI)