cas: 28022-43-7 — see every product listed under this CAS number, including other names
(4-Chlorophenyl)(phenyl)methanamine 97% (CAS 28022-43-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A362545-100mg |
| cas | 28022-43-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 270.25 Pln | |
| Ambeed | 250mg | 325.88 Pln | |
| Ambeed | 1g | 654.06 Pln | |
| Ambeed | 5g | 2244.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A362545 |
(4-chlorophenyl)-phenylmethanamine (CAS 28022-43-7) is a chemical compound with the molecular formula C13H12ClN and a molecular weight of 217.69 g/mol. IUPAC name: (4-chlorophenyl)-phenylmethanamine. InChIKey: XAFODXGEQUOEKN-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (4-chlorophenyl)-phenylmethanamine |
| InChIKey | XAFODXGEQUOEKN-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C(C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)