Products 361982-79-8
CAS 361982-79-8 is the registry number for 2-Chloro-4-methyl-7,8-dihydro-6h-cyclopenta[g]quinoline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 50g, 1g, 5g.
2-chloro-4-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline (CAS 361982-79-8) is a chemical compound with the molecular formula C13H12ClN and a molecular weight of 217.69 g/mol. IUPAC name: 2-chloro-4-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline. InChIKey: PPGREYUBXFOZBC-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 2-chloro-4-methyl-7,8-dihydro-6H-cyclopenta[g]quinoline |
| InChIKey | PPGREYUBXFOZBC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC2=C1C=C3CCCC3=C2)Cl |
Computed by PubChem (NCBI)