CAS 244159-51-1 is the registry number for 5-(4-Chlorophenyl)-2-methylaniline, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.
5-(4-chlorophenyl)-2-methylaniline (CAS 244159-51-1) is a chemical compound with the molecular formula C13H12ClN and a molecular weight of 217.69 g/mol. IUPAC name: 5-(4-chlorophenyl)-2-methylaniline. InChIKey: MHMDGEYICUKJMZ-UHFFFAOYSA-N.
| Molecular formula | C13H12ClN |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | 5-(4-chlorophenyl)-2-methylaniline |
| InChIKey | MHMDGEYICUKJMZ-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)