CAS 163837-32-9 appears in our catalog under these names: (-)-4-Chlorobenzhydrylamine, 95%, (S)–(4–Chlorophenyl)(phenyl)methanamine. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 100mg.
(S)-(4-chlorophenyl)-phenylmethanamine (CAS 163837-32-9) is a chemical compound with the molecular formula C13H12ClN and a molecular weight of 217.69 g/mol. IUPAC name: (S)-(4-chlorophenyl)-phenylmethanamine. InChIKey: XAFODXGEQUOEKN-ZDUSSCGKSA-N.
| Molecular formula | C13H12ClN |
|---|---|
| Molecular weight | 217.69 g/mol |
| IUPAC name | (S)-(4-chlorophenyl)-phenylmethanamine |
| InChIKey | XAFODXGEQUOEKN-ZDUSSCGKSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](C2=CC=C(C=C2)Cl)N |
Computed by PubChem (NCBI)