Products 2377587-40-9
CAS 2377587-40-9 appears in our catalog under these names: 2-(1-Cyanoethyl)phenylboronic acid, 95%, (2-(1-Cyanoethyl)phenyl)boronic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
[2-(1-cyanoethyl)phenyl]boronic acid (CAS 2377587-40-9) is a chemical compound with the molecular formula C9H10BNO2 and a molecular weight of 174.99 g/mol. IUPAC name: [2-(1-cyanoethyl)phenyl]boronic acid. InChIKey: JLODEADFYWKFEK-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO2 |
|---|---|
| Molecular weight | 174.99 g/mol |
| IUPAC name | [2-(1-cyanoethyl)phenyl]boronic acid |
| InChIKey | JLODEADFYWKFEK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1C(C)C#N)(O)O |
Computed by PubChem (NCBI)