CAS 1451391-43-7 appears in our catalog under these names: 4-Cyano-2,6-dimethylphenylboronic acid, 95%, (4-Cyano-2,6-dimethylphenyl)boronic acid, 95%, 4–cyano–2，6–dimethylphenylboronic acid, 4-Cyano-2,6-dimethylphenylboronic acid, (4-Cyano-2,6-dimethylphenyl)boronic acid 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Biosynth, Chemat. Available pack sizes: 1g, 10g, 25mg, 250mg, 2,5g, 100mg, 5g.
(4-cyano-2,6-dimethylphenyl)boronic acid (CAS 1451391-43-7) is a chemical compound with the molecular formula C9H10BNO2 and a molecular weight of 174.99 g/mol. IUPAC name: (4-cyano-2,6-dimethylphenyl)boronic acid. InChIKey: JTJKZJPBCISPOI-UHFFFAOYSA-N.
| Molecular formula | C9H10BNO2 |
|---|---|
| Molecular weight | 174.99 g/mol |
| IUPAC name | (4-cyano-2,6-dimethylphenyl)boronic acid |
| InChIKey | JTJKZJPBCISPOI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1C)C#N)C)(O)O |
Computed by PubChem (NCBI)