cas: 943830-75-9 — see every product listed under this CAS number, including other names
(4-Fluorobenzo[d][1,3]dioxol-5-yl)boronic acid 95% (CAS 943830-75-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A970040-100mg |
| cas | 943830-75-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 698.56 Pln | |
| Ambeed | 250mg | 1010.06 Pln | |
| Ambeed | 1g | 2428.50 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A970040 |
(4-fluoro-1,3-benzodioxol-5-yl)boronic acid (CAS 943830-75-9) is a chemical compound with the molecular formula C7H6BFO4 and a molecular weight of 183.93 g/mol. IUPAC name: (4-fluoro-1,3-benzodioxol-5-yl)boronic acid. InChIKey: IIUUBGPDUHFEQA-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO4 |
|---|---|
| Molecular weight | 183.93 g/mol |
| IUPAC name | (4-fluoro-1,3-benzodioxol-5-yl)boronic acid |
| InChIKey | IIUUBGPDUHFEQA-UHFFFAOYSA-N |
| SMILES | B(C1=C(C2=C(C=C1)OCO2)F)(O)O |
Computed by PubChem (NCBI)