Products 874290-62-7
CAS 874290-62-7 appears in our catalog under these names: 2-Carboxy-5-fluorophenylboronic acid, 96%, 2-Carboxy-5-fluorobenzeneboronic acid 96%, 2-Carboxy-5-fluorobenzeneboronic acid, 96%, 96%, 2-Carboxy-5-fluorobenzeneboronic acid. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 25g, 100g, 1g, 250mg, 10g.
2-borono-4-fluorobenzoic acid (CAS 874290-62-7) is a chemical compound with the molecular formula C7H6BFO4 and a molecular weight of 183.93 g/mol. IUPAC name: 2-borono-4-fluorobenzoic acid. InChIKey: OSMLMMRXRIGREO-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO4 |
|---|---|
| Molecular weight | 183.93 g/mol |
| IUPAC name | 2-borono-4-fluorobenzoic acid |
| InChIKey | OSMLMMRXRIGREO-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)