Products 871329-84-9
CAS 871329-84-9 appears in our catalog under these names: 3-Carboxy-5-fluorophenylboronic acid, 98%, 3–Carboxy–5–fluorobenzeneboronic acid(contains varying amounts of Anhydride), 3-Carboxy-5-fluorophenylboronic Acid (contains varying amounts of Anhydride), 3-Borono-5-fluorobenzoic acid 98%, 3-Borono-5-fluorobenzoic acid, 95%, 95%. Offered by: Combi-blocks, GLPBio, TCI, Ambeed, Chemat. Available pack sizes: 5g, 25g, 100g, 1g.
3-borono-5-fluorobenzoic acid (CAS 871329-84-9) is a chemical compound with the molecular formula C7H6BFO4 and a molecular weight of 183.93 g/mol. IUPAC name: 3-borono-5-fluorobenzoic acid. InChIKey: APHPXZJIUTVQNC-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO4 |
|---|---|
| Molecular weight | 183.93 g/mol |
| IUPAC name | 3-borono-5-fluorobenzoic acid |
| InChIKey | APHPXZJIUTVQNC-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC(=C1)F)C(=O)O)(O)O |
Computed by PubChem (NCBI)
Synonyms:
3-borono-5-fluorobenzoic acid, 3-Carboxy-5-fluorophenylboronic acid, (3-Carboxy-5-Fluoro)Benzeneboronic Acid, 3-borono-5-fluoro-benzoic acid, 3-Borono-5-fluorobenzoicacid, 3-Carboxy-5-fluorobenzeneboronic acid, 3-Carboxy-5-fluorophenylboronic acid, >=95%, 3-(dihydroxyboranyl)-5-fluorobenzoic acid, 3-(Dihydroxyboryl)-5-fluorobenzoic acid, 3-Carboxy-5-fluorobenzeneboronic acid(contains varying amounts of Anhydride)