Products 1256345-92-2
CAS 1256345-92-2 is the registry number for 4-Fluoro-2,3-methylenedioxyphenylboronic acid, 98%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
(7-fluoro-1,3-benzodioxol-4-yl)boronic acid (CAS 1256345-92-2) is a chemical compound with the molecular formula C7H6BFO4 and a molecular weight of 183.93 g/mol. IUPAC name: (7-fluoro-1,3-benzodioxol-4-yl)boronic acid. InChIKey: MZBRLFXVMFAXIT-UHFFFAOYSA-N.
| Molecular formula | C7H6BFO4 |
|---|---|
| Molecular weight | 183.93 g/mol |
| IUPAC name | (7-fluoro-1,3-benzodioxol-4-yl)boronic acid |
| InChIKey | MZBRLFXVMFAXIT-UHFFFAOYSA-N |
| SMILES | B(C1=C2C(=C(C=C1)F)OCO2)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Fluoro-2,3-methylenedioxyphenylboronic acid, (7-Fluorobenzo[d][1,3]dioxol-4-yl)boronic acid, (7-fluoro-1,3-benzodioxol-4-yl)boronic acid, 7-Fluorobenzo[d][1,3]dioxol-4-ylboronic acid, (7-Fluoro-2H-1,3-benzodioxol-4-yl)boronic acid, Boronic acid, B-(7-fluoro-1,3-benzodioxol-4-yl)-, (7-Fluorobenzo[d][1,3]dioxol-4-yl)boronicacid