(4-Formyl-3-methylphenyl)boronic acid, 98%, 98%
cas: 398151-59-2 — see every product listed under this CAS number, including other names
(4-Formyl-3-methylphenyl)boronic acid, 98%, 98% (CAS 398151-59-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11888G-100mg |
| cas | 398151-59-2 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 318.80 Pln | |
| Chemat | 250mg | 501.20 Pln | |
| Chemat | 1g | 1178.00 Pln | |
| Chemat | 5g | 3539.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4-formyl-3-methylphenyl)boronic acid (CAS 398151-59-2) is a chemical compound with the molecular formula C8H9BO3 and a molecular weight of 163.97 g/mol. IUPAC name: (4-formyl-3-methylphenyl)boronic acid. InChIKey: SSVPHQYUDZPVQX-UHFFFAOYSA-N.
| Molecular formula | C8H9BO3 |
|---|---|
| Molecular weight | 163.97 g/mol |
| IUPAC name | (4-formyl-3-methylphenyl)boronic acid |
| InChIKey | SSVPHQYUDZPVQX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C=O)C)(O)O |
Computed by PubChem (NCBI)