cas: 934826-20-7 — see every product listed under this CAS number, including other names
(4-Hydroxy-3,5-dimethylphenyl)boronic acid (CAS 934826-20-7) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338103-1G |
| cas | 934826-20-7 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1752.53 Pln | |
| Fluorochem | 5g | 5110.72 Pln |
| delivery time | 3-4 weeks |
|---|
(4-hydroxy-3,5-dimethylphenyl)boronic acid (CAS 934826-20-7) is a chemical compound with the molecular formula C8H11BO3 and a molecular weight of 165.98 g/mol. IUPAC name: (4-hydroxy-3,5-dimethylphenyl)boronic acid. InChIKey: SJSCEQJHOXBRSS-UHFFFAOYSA-N.
| Molecular formula | C8H11BO3 |
|---|---|
| Molecular weight | 165.98 g/mol |
| IUPAC name | (4-hydroxy-3,5-dimethylphenyl)boronic acid |
| InChIKey | SJSCEQJHOXBRSS-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C(=C1)C)O)C)(O)O |
Computed by PubChem (NCBI)