(4-Isobutoxyphenyl)methanamine hydrochloride, 97%
cas: 37806-44-3 — see every product listed under this CAS number, including other names
(4-Isobutoxyphenyl)methanamine hydrochloride, 97% (CAS 37806-44-3) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A627275-1g |
| cas | 37806-44-3 |
| size | 1g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 131.19 Pln | |
| Ambeed | 5g | 286.94 Pln | |
| Ambeed | 25g | 765.31 Pln | |
| Ambeed | 100g | 2356.19 Pln | |
| Chemat | 1g | 141.20 Pln | |
| Chemat | 5g | 314.00 Pln | |
| Chemat | 25g | 866.00 Pln | |
| Chemat | 100g | 2709.20 Pln | |
| BLDpharm | 1g | 136.64 Pln | |
| BLDpharm | 5g | 303.25 Pln | |
| BLDpharm | 25g | 819.74 Pln | |
| BLDpharm | 100g | 2535.80 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[4-(2-methylpropoxy)phenyl]methanamine;hydrochloride (CAS 37806-44-3) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: [4-(2-methylpropoxy)phenyl]methanamine;hydrochloride. InChIKey: BHKUKNJDPIWLRY-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | [4-(2-methylpropoxy)phenyl]methanamine;hydrochloride |
| InChIKey | BHKUKNJDPIWLRY-UHFFFAOYSA-N |
| SMILES | CC(C)COC1=CC=C(C=C1)CN.Cl |
Computed by PubChem (NCBI)
Synonyms:
[4-(2-Methylpropoxy)phenyl]methanamine Hydrochloride, (4-(2-methylpropoxy)phenyl)methanamine hydrochloride, (4-isobutoxyphenyl)methanamine hydrochloride, 4-(2-methylpropoxy)benzenemethanamine hydrochloride, [4-(2-methylpropoxy)phenyl]methanamine;hydrochloride, (4-isobutoxyphenyl)methanaminehydrochloride