CAS 56490-93-8 appears in our catalog under these names: 1-(4-Methoxyphenyl)-2-methylpropan-2-amine hydrochloride, 95%, 1-(4-Methoxyphenyl)-2-methylpropan-2-amine Hydrochloride, 4-Methoxy-α,α-dimethylbenzeneethanamine hydrochloride, 98%, 98%, 1-(4-Methoxyphenyl)-2-methylpropan-2-amine hydrochloride, 98%. Offered by: Combi-blocks, TRC, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 25mg, 5g, 10g, 25g.
1-(4-methoxyphenyl)-2-methylpropan-2-amine;hydrochloride (CAS 56490-93-8) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 1-(4-methoxyphenyl)-2-methylpropan-2-amine;hydrochloride. InChIKey: BXOCBNXPOIPDTL-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 1-(4-methoxyphenyl)-2-methylpropan-2-amine;hydrochloride |
| InChIKey | BXOCBNXPOIPDTL-UHFFFAOYSA-N |
| SMILES | CC(C)(CC1=CC=C(C=C1)OC)N.Cl |
Computed by PubChem (NCBI)