CAS 473703-95-6 appears in our catalog under these names: 5-Isopropyl-4-methoxy-2-methylaniline hydrochloride, 95+%, 5-Isopropyl-4-methoxy-2-methyl-phenylamine hydrochloride, 95%. Offered by: AmBeed, Combi-blocks. Available pack sizes: 5g, 250mg, 1g.
4-methoxy-2-methyl-5-propan-2-ylaniline;hydrochloride (CAS 473703-95-6) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 4-methoxy-2-methyl-5-propan-2-ylaniline;hydrochloride. InChIKey: FQMDGRJHBVBUTR-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 4-methoxy-2-methyl-5-propan-2-ylaniline;hydrochloride |
| InChIKey | FQMDGRJHBVBUTR-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1N)C(C)C)OC.Cl |
Computed by PubChem (NCBI)