Products 5370-01-4
CAS 5370-01-4 appears in our catalog under these names: Mexiletine hydrochloride, 98%, Mexiletine HCl, Mexiletine Hydrochloride, >95% (HPLC), Mexiletine Hydrochloride, Mexiletine (hydrochloride). Offered by: Combi-blocks, Chemat Brand, TRC, Mikromol, LoGiCal. Available pack sizes: 100g, 25g, 5g, 500g, on request, 10g, 1g, 50mg.
1-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride (CAS 5370-01-4) is a chemical compound with the molecular formula C11H18ClNO and a molecular weight of 215.72 g/mol. IUPAC name: 1-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride. InChIKey: NFEIBWMZVIVJLQ-UHFFFAOYSA-N.
| Molecular formula | C11H18ClNO |
|---|---|
| Molecular weight | 215.72 g/mol |
| IUPAC name | 1-(2,6-dimethylphenoxy)propan-2-amine;hydrochloride |
| InChIKey | NFEIBWMZVIVJLQ-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC=C1)C)OCC(C)N.Cl |
Computed by PubChem (NCBI)
Synonyms:
Mexiletine hydrochloride, Mexiletine HCL, Katen, 1-(2,6-Dimethylphenoxy)-2-propanamine hydrochloride, Ko 1173 Cl, 1-Methyl-2-(2,6-xylyloxy)ethylammonium chloride, 1-Methyl-2-(2,6-xylyloxy)ethylamine hydrochloride, 1-(2,6-Dimethylphenoxy)-2-aminopropane hydrochloride, Mexitil p.l., (1RS)-2-(2,6-Dimethylphenoxy)-1-methylethylamine monohydrochloride