cas: 313545-40-3 — see every product listed under this CAS number, including other names
(4-Isopropoxy-2-(trifluoromethyl)phenyl)boronic acid (CAS 313545-40-3) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F219137-1G |
| cas | 313545-40-3 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1101.71 Pln |
| delivery time | 3-4 weeks |
|---|
[4-propan-2-yloxy-2-(trifluoromethyl)phenyl]boronic acid (CAS 313545-40-3) is a chemical compound with the molecular formula C10H12BF3O3 and a molecular weight of 248.01 g/mol. IUPAC name: [4-propan-2-yloxy-2-(trifluoromethyl)phenyl]boronic acid. InChIKey: MQWMPOPSYRZCAI-UHFFFAOYSA-N.
| Molecular formula | C10H12BF3O3 |
|---|---|
| Molecular weight | 248.01 g/mol |
| IUPAC name | [4-propan-2-yloxy-2-(trifluoromethyl)phenyl]boronic acid |
| InChIKey | MQWMPOPSYRZCAI-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)OC(C)C)C(F)(F)F)(O)O |
Computed by PubChem (NCBI)